Indigo Service: enable of using Indigo Options

[AATDev21]

Steps to Reproduce

1. Use Indige Service from epmlsop/indigo-service:enhanced-1.10.0
2. Call /indigo/descriptors with the following request:

{
  "data": {
    "type": "descriptor",
    "attributes": {
      "compound": {
        "structure": "InChI=1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3",
        "format": "auto"
      },
      "options": {
        "gross-formula-add-isotopes": 1
      },
      "descriptors": [
        "grossFormula"
      ]
    }
  }
}

Expected behavior
A gross formula of the compound with correct representation of isotopes ('D' as deuterium in this case)

Actual behavior
Option "gross-formula-add-isotopes" had no effect on the response body:

{
  "data": {
    "type": "descriptorResult",
    "attributes": {
      "grossFormula": "C2 H6 O S"
    }
  }
}